CAS 2708280-88-8 appears in our catalog under these names: Bis(5-methylhexyl) Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Bis(5-methylhexyl) Phthalate-3,4,5,6-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
Bis(5-methylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 2708280-88-8) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 366.5 g/mol. IUPAC name: bis(5-methylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: RKELNIPLHQEBJO-WTMZIVFJSA-N.
| Molecular formula | C22H34O4 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | bis(5-methylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | RKELNIPLHQEBJO-WTMZIVFJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCCC(C)C)C(=O)OCCCCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)