Products 89-18-9
CAS 89-18-9 is the registry number for Phthalic acid, butyl-isodecyl ester. Offered by: Dr. Ehrenstorfer. Available pack sizes: 50mg.
1-O-butyl 2-O-(8-methylnonyl) benzene-1,2-dicarboxylate (CAS 89-18-9) is a chemical compound with the molecular formula C22H34O4 and a molecular weight of 362.5 g/mol. IUPAC name: 1-O-butyl 2-O-(8-methylnonyl) benzene-1,2-dicarboxylate. InChIKey: IOVNHINTOHPELQ-UHFFFAOYSA-N.
| Molecular formula | C22H34O4 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | 1-O-butyl 2-O-(8-methylnonyl) benzene-1,2-dicarboxylate |
| InChIKey | IOVNHINTOHPELQ-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
BUTYL ISODECYL PHTHALATE, 1,2-Benzenedicarboxylic acid, 1-butyl 2-isodecyl ester, Phthalic acid, butyl 8-methylnonyl ester, Butyl 8-methylnonyl phthalate, 1-O-butyl 2-O-(8-methylnonyl) benzene-1,2-dicarboxylate, Butyl (8-methylnonyl) phthalate, Phthalic acid, butyl-isodecyl ester, 1,2-Benzenedicarboxylic acid, butyl 8-methylnonyl ester, Butyl isodecyl phthalate(Technical), 1, butyl 8-methylnonyl ester