Products 855152-60-2
CAS 855152-60-2 is the registry number for 4-(2,5-Dichlorophenyl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2,5-dichlorophenyl)butanoic acid (CAS 855152-60-2) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 4-(2,5-dichlorophenyl)butanoic acid. InChIKey: WSKILGBCDDSQPQ-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 4-(2,5-dichlorophenyl)butanoic acid |
| InChIKey | WSKILGBCDDSQPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CCCC(=O)O)Cl |
Computed by PubChem (NCBI)