CAS 855423-61-9 appears in our catalog under these names: 5-Bromo-7-chloro-1,3-dihydro-indol-2-one, 96%, 5-Bromo-7-chloro-1,3-dihydro-indol-2-one, 96%, 96%, 5-Bromo-7-chloroindolin-2-one, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g, 10g.
5-bromo-7-chloro-1,3-dihydroindol-2-one (CAS 855423-61-9) is a chemical compound with the molecular formula C8H5BrClNO and a molecular weight of 246.49 g/mol. IUPAC name: 5-bromo-7-chloro-1,3-dihydroindol-2-one. InChIKey: QTNYNHKPFHRQTB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNO |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 5-bromo-7-chloro-1,3-dihydroindol-2-one |
| InChIKey | QTNYNHKPFHRQTB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Br)Cl)NC1=O |
Computed by PubChem (NCBI)