CAS 855741-90-1 is the registry number for (3-Methylisoxazole-5-carbonyl)glycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-methyl-1,2-oxazole-5-carbonyl)amino]acetic acid (CAS 855741-90-1) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 2-[(3-methyl-1,2-oxazole-5-carbonyl)amino]acetic acid. InChIKey: CATVGYXZPHNIPI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2-[(3-methyl-1,2-oxazole-5-carbonyl)amino]acetic acid |
| InChIKey | CATVGYXZPHNIPI-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)