CAS 855871-35-1 is the registry number for 7-Chloro-3-methoxyquinolin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
7-chloro-3-methoxy-1H-quinolin-4-one (CAS 855871-35-1) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 7-chloro-3-methoxy-1H-quinolin-4-one. InChIKey: HGKQQHSIEWOSNI-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 7-chloro-3-methoxy-1H-quinolin-4-one |
| InChIKey | HGKQQHSIEWOSNI-UHFFFAOYSA-N |
| SMILES | COC1=CNC2=C(C1=O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)