CAS 855871-94-2 appears in our catalog under these names: 6-Phenoxy-1,4-dihydroquinolin-4-one, 95%, 6-Phenoxy-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-phenoxy-1H-quinolin-4-one (CAS 855871-94-2) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 6-phenoxy-1H-quinolin-4-one. InChIKey: BBMPRDGTSPIYCL-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 6-phenoxy-1H-quinolin-4-one |
| InChIKey | BBMPRDGTSPIYCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC3=C(C=C2)NC=CC3=O |
Computed by PubChem (NCBI)