CAS 855931-91-8 is the registry number for N-Nitroso-N-Phenyl-Glycine Anilide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-(N-nitrosoanilino)-N-phenylacetamide (CAS 855931-91-8) is a chemical compound with the molecular formula C14H13N3O2 and a molecular weight of 255.27 g/mol. IUPAC name: 2-(N-nitrosoanilino)-N-phenylacetamide. InChIKey: ZBUNFZLMGDKJPE-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O2 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 2-(N-nitrosoanilino)-N-phenylacetamide |
| InChIKey | ZBUNFZLMGDKJPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)CN(C2=CC=CC=C2)N=O |
Computed by PubChem (NCBI)