Products 855991-54-7
CAS 855991-54-7 appears in our catalog under these names: 9-Chloro-3,4-dihydro-2h-1,5-benzodioxepine-7-carbonitrile, 95%, 9-Chloro-3,4-dihydro-2H-1,5-benzodioxepine-7-carbonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
6-chloro-3,4-dihydro-2H-1,5-benzodioxepine-8-carbonitrile (CAS 855991-54-7) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-1,5-benzodioxepine-8-carbonitrile. InChIKey: JRRIILKHMRCTNI-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-1,5-benzodioxepine-8-carbonitrile |
| InChIKey | JRRIILKHMRCTNI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C(=CC(=C2)C#N)Cl)OC1 |
Computed by PubChem (NCBI)