Products 856343-37-8
CAS 856343-37-8 is the registry number for 8-Chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 100mg.
8-chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 856343-37-8) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: SGANSTIMXCILJP-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 8-chloro-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | SGANSTIMXCILJP-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NN=CN2C=C1C(=O)O)Cl |
Computed by PubChem (NCBI)