CAS 856412-21-0 appears in our catalog under these names: (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)(methyl)amino)hex–5–enoic acid, Fmoc-N-Me-Abu(Vinyl)-OH 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)hex-5-enoic acid, 98%, 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)hex-5-enoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 25g, 5g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hex-5-enoic acid (CAS 856412-21-0) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hex-5-enoic acid. InChIKey: WEIZUZAGVKXOOD-FQEVSTJZSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hex-5-enoic acid |
| InChIKey | WEIZUZAGVKXOOD-FQEVSTJZSA-N |
| SMILES | CN([C@@H](CCC=C)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)