CAS 856832-08-1 is the registry number for 4-Iodoisoindoline-1,3-dione, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-iodoisoindole-1,3-dione (CAS 856832-08-1) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 4-iodoisoindole-1,3-dione. InChIKey: GWIPRGVTJBZBAG-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 4-iodoisoindole-1,3-dione |
| InChIKey | GWIPRGVTJBZBAG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)C(=O)NC2=O |
Computed by PubChem (NCBI)