Products 856846-79-2

CAS 856846-79-2 is the registry number for Penicillamine Impurity 3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N-(5-oxo-1,4-dihydropyrazol-4-yl)-2-phenylacetamide (CAS 856846-79-2) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: N-(5-oxo-1,4-dihydropyrazol-4-yl)-2-phenylacetamide. InChIKey: LIHLZABITWNLPR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O2
Molecular weight217.22 g/mol
IUPAC nameN-(5-oxo-1,4-dihydropyrazol-4-yl)-2-phenylacetamide
InChIKeyLIHLZABITWNLPR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(=O)NC2C=NNC2=O

Computed by PubChem (NCBI)