Products 85740-98-3
CAS 85740-98-3 appears in our catalog under these names: 4-Chloro-3-methoxybenzoic acid, 4-Chloro-3-methoxybenzoic acid 97%, 4-Chloro-3-methoxybenzoic acid, 95%, 4-Chloro-3-methoxybenzoic Acid, >98.0%(GC)(T), Benzoic acid, 4-chloro-3-methoxy-, 97%, 97%. Offered by: Biosynth, Ambeed, Fluorochem, TCI, Chemat. Available pack sizes: 100g, 50g, 1g, 5g, 10g, 25g.
4-chloro-3-methoxybenzoic acid (CAS 85740-98-3) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 4-chloro-3-methoxybenzoic acid. InChIKey: OXUUNDMDOOXPKY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 4-chloro-3-methoxybenzoic acid |
| InChIKey | OXUUNDMDOOXPKY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)