CAS 85743-02-8 appears in our catalog under these names: Methyl 3-Amino-4-carboxybenzoate, 2-Amino-4-(methoxycarbonyl)benzoic acid 97%, 2-Amino-4-(methoxycarbonyl)benzoic acid, 97%, 97%, 2-Amino-4-(methoxycarbonyl)benzoic acid, 96%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g.
2-amino-4-methoxycarbonylbenzoic acid (CAS 85743-02-8) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-amino-4-methoxycarbonylbenzoic acid. InChIKey: WOLYDIFKLNALLS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-amino-4-methoxycarbonylbenzoic acid |
| InChIKey | WOLYDIFKLNALLS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)O)N |
Computed by PubChem (NCBI)