Products 857494-36-1
CAS 857494-36-1 is the registry number for Methyl 2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-5-propylthiophene-3-carboxylate, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Methyl 2-(2,5-dioxopyrrol-1-yl)-5-propylthiophene-3-carboxylate (CAS 857494-36-1) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: methyl 2-(2,5-dioxopyrrol-1-yl)-5-propylthiophene-3-carboxylate. InChIKey: MWVJEYOOMDHOSF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4S |
|---|---|
| Molecular weight | 279.31 g/mol |
| IUPAC name | methyl 2-(2,5-dioxopyrrol-1-yl)-5-propylthiophene-3-carboxylate |
| InChIKey | MWVJEYOOMDHOSF-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=C(S1)N2C(=O)C=CC2=O)C(=O)OC |
Computed by PubChem (NCBI)