CAS 858012-57-4 is the registry number for 2,3-Dichloro-5,6-dimethylbenzene-1,4-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3-dichloro-5,6-dimethylbenzene-1,4-diamine (CAS 858012-57-4) is a chemical compound with the molecular formula C8H10Cl2N2 and a molecular weight of 205.08 g/mol. IUPAC name: 2,3-dichloro-5,6-dimethylbenzene-1,4-diamine. InChIKey: OMOUJLDAHBMPLK-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2 |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 2,3-dichloro-5,6-dimethylbenzene-1,4-diamine |
| InChIKey | OMOUJLDAHBMPLK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1N)Cl)Cl)N)C |
Computed by PubChem (NCBI)