Products 858186-27-3
CAS 858186-27-3 appears in our catalog under these names: 4-Aminonaphthalen-1-yl acetate, 4-Aminonaphthalen-1-yl acetate 95%, 4-Aminonaphthalen-1-yl acetate, 95%, 95%, 4-aminonaphthalen-1-yl acetate, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(4-aminonaphthalen-1-yl) acetate (CAS 858186-27-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: (4-aminonaphthalen-1-yl) acetate. InChIKey: RQKMOUJASOVRPY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (4-aminonaphthalen-1-yl) acetate |
| InChIKey | RQKMOUJASOVRPY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C2=CC=CC=C21)N |
Computed by PubChem (NCBI)