CAS 858215-05-1 appears in our catalog under these names: MDA 2–amido analog, Alpha-Methyl-1,3-benzodioxole-5-propanamide, >95% (HPLC), MMDPPA. Offered by: GLPBio, TRC, Chemat, MedChemExpress. Available pack sizes: 1mg, 100mg, 1g, 500mg, 5mg, 25mg, 50mg, 5 mg.
3-(1,3-benzodioxol-5-yl)-2-methylpropanamide (CAS 858215-05-1) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-2-methylpropanamide. InChIKey: WJHISTBMGKCBDJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-2-methylpropanamide |
| InChIKey | WJHISTBMGKCBDJ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)OCO2)C(=O)N |
Computed by PubChem (NCBI)