Products 859188-26-4

CAS 859188-26-4 is the registry number for 3-Methylpyridine-2,4-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-methylpyridine-2,4-dicarboxylic acid (CAS 859188-26-4) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 3-methylpyridine-2,4-dicarboxylic acid. InChIKey: GBKJTNBQWNHJNX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO4
Molecular weight181.15 g/mol
IUPAC name3-methylpyridine-2,4-dicarboxylic acid
InChIKeyGBKJTNBQWNHJNX-UHFFFAOYSA-N
SMILESCC1=C(C=CN=C1C(=O)O)C(=O)O

Computed by PubChem (NCBI)