CAS 859188-26-4 is the registry number for 3-Methylpyridine-2,4-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methylpyridine-2,4-dicarboxylic acid (CAS 859188-26-4) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 3-methylpyridine-2,4-dicarboxylic acid. InChIKey: GBKJTNBQWNHJNX-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-methylpyridine-2,4-dicarboxylic acid |
| InChIKey | GBKJTNBQWNHJNX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)