CAS 859470-58-9 is the registry number for 2-(Chloromethyl)-5-phenyl-1,3-thiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-5-phenyl-1,3-thiazole (CAS 859470-58-9) is a chemical compound with the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. IUPAC name: 2-(chloromethyl)-5-phenyl-1,3-thiazole. InChIKey: JEJHXSCVDJNWCE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNS |
|---|---|
| Molecular weight | 209.70 g/mol |
| IUPAC name | 2-(chloromethyl)-5-phenyl-1,3-thiazole |
| InChIKey | JEJHXSCVDJNWCE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(S2)CCl |
Computed by PubChem (NCBI)