Products 859968-65-3
CAS 859968-65-3 is the registry number for 4-Bromo-6-(bromomethyl)-1,3-dioxaindane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-6-(bromomethyl)-1,3-benzodioxole (CAS 859968-65-3) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: 4-bromo-6-(bromomethyl)-1,3-benzodioxole. InChIKey: DDASRZHCCCVBJJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 4-bromo-6-(bromomethyl)-1,3-benzodioxole |
| InChIKey | DDASRZHCCCVBJJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)CBr)Br |
Computed by PubChem (NCBI)