Products 860502-84-7
CAS 860502-84-7 appears in our catalog under these names: 3-oxo-4-phenylquinoxaline-2-carboxylic acid, 95+%, 95+%, 3-OXO-4-PHENYL-3,4-DIHYDROQUINOXALINE-2-CARBOXYLIC ACID, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
3-oxo-4-phenylquinoxaline-2-carboxylic acid (CAS 860502-84-7) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 3-oxo-4-phenylquinoxaline-2-carboxylic acid. InChIKey: GMDXHYKTWCGQGM-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 3-oxo-4-phenylquinoxaline-2-carboxylic acid |
| InChIKey | GMDXHYKTWCGQGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3N=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)