CAS 860585-53-1 appears in our catalog under these names: 6-Chlorobenzo(d)(1,3)dioxol-5-amine hydrochloride, 97%, 6-Chloro-1,3-dioxaindan-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g.
6-chloro-1,3-benzodioxol-5-amine;hydrochloride (CAS 860585-53-1) is a chemical compound with the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. IUPAC name: 6-chloro-1,3-benzodioxol-5-amine;hydrochloride. InChIKey: VFRWGYBNVDWZBP-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2 |
|---|---|
| Molecular weight | 208.04 g/mol |
| IUPAC name | 6-chloro-1,3-benzodioxol-5-amine;hydrochloride |
| InChIKey | VFRWGYBNVDWZBP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)N)Cl.Cl |
Computed by PubChem (NCBI)