Products 861207-55-8
CAS 861207-55-8 is the registry number for 4-[(6-Chloro-3-pyridinyl)methoxy]benzenecarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[(6-chloro-3-pyridinyl)methoxy]benzonitrile (CAS 861207-55-8) is a chemical compound with the molecular formula C13H9ClN2O and a molecular weight of 244.67 g/mol. IUPAC name: 4-[(6-chloro-3-pyridinyl)methoxy]benzonitrile. InChIKey: YPSFUWUIBXQKPR-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 4-[(6-chloro-3-pyridinyl)methoxy]benzonitrile |
| InChIKey | YPSFUWUIBXQKPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OCC2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)