CAS 50892-62-1 appears in our catalog under these names: 8-Chloro-5,10-dihydro-11h-dibenzo[b,e][1,4]-diazepin-11-one, 97%, Clozapine EP Impurity A, Clozapine Impurity A( EP), 8-Chloro-5,10-dihydro-11H-dibenzo(b,e)(1,4)-diazepin-11-one, >95% (HPLC), 8-Chloro-5,10-dihydro-11H-dibenzo(b,e)(1,4)diazepin-11-one. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 10g, 100g, 5g, 25g, 1g, on request, 100mg, 50mg.
3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CAS 50892-62-1) is a chemical compound with the molecular formula C13H9ClN2O and a molecular weight of 244.67 g/mol. IUPAC name: 3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one. InChIKey: YVWNDABPZGGQFE-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| InChIKey | YVWNDABPZGGQFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)