CAS 1134316-96-3 is the registry number for 2-(2-Chlorophenyl)-1,3-benzoxazol-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2-chlorophenyl)-1,3-benzoxazol-6-amine (CAS 1134316-96-3) is a chemical compound with the molecular formula C13H9ClN2O and a molecular weight of 244.67 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,3-benzoxazol-6-amine. InChIKey: JAUJLLJKGXLRIZ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,3-benzoxazol-6-amine |
| InChIKey | JAUJLLJKGXLRIZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(O2)C=C(C=C3)N)Cl |
Computed by PubChem (NCBI)