CAS 104-24-5 appears in our catalog under these names: 4-Phenylazobenzoyl chloride, 95%, 4–Phenylazobenzoyl Chloride, 4-Phenylazobenzoyl Chloride, >98.0%(GC)(T), 4-Phenylazobenzoyl chloride, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 5g, 1g, 200mg, 250mg.
4-phenyldiazenylbenzoyl chloride (CAS 104-24-5) is a chemical compound with the molecular formula C13H9ClN2O and a molecular weight of 244.67 g/mol. IUPAC name: 4-phenyldiazenylbenzoyl chloride. InChIKey: RYMHZBAYPLCCAC-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 4-phenyldiazenylbenzoyl chloride |
| InChIKey | RYMHZBAYPLCCAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)