CAS 54995-51-6 is the registry number for 2-(4-Chlorophenyl)-1,3-benzoxazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
2-(4-chlorophenyl)-1,3-benzoxazol-5-amine (CAS 54995-51-6) is a chemical compound with the molecular formula C13H9ClN2O and a molecular weight of 244.67 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-benzoxazol-5-amine. InChIKey: VTAPQLUVHHVZFW-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | VTAPQLUVHHVZFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)N)Cl |
Computed by PubChem (NCBI)