CAS 1071350-94-1 is the registry number for 3-(6-Chloro-1,3-benzoxazol-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(6-chloro-1,3-benzoxazol-2-yl)aniline (CAS 1071350-94-1) is a chemical compound with the molecular formula C13H9ClN2O and a molecular weight of 244.67 g/mol. IUPAC name: 3-(6-chloro-1,3-benzoxazol-2-yl)aniline. InChIKey: UYOQZGWIBYYUPP-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 3-(6-chloro-1,3-benzoxazol-2-yl)aniline |
| InChIKey | UYOQZGWIBYYUPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)