Products 86122-64-7
CAS 86122-64-7 is the registry number for dibenzyl (2S,3S)-3-methylaziridine-1,2-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibenzyl (2S,3S)-3-methylaziridine-1,2-dicarboxylate (CAS 86122-64-7) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: dibenzyl (2S,3S)-3-methylaziridine-1,2-dicarboxylate. InChIKey: KCSOTXCFIPSYOB-OJIYZUOWSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | dibenzyl (2S,3S)-3-methylaziridine-1,2-dicarboxylate |
| InChIKey | KCSOTXCFIPSYOB-OJIYZUOWSA-N |
| SMILES | C[C@H]1[C@H](N1C(=O)OCC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)