CAS 86125-71-5 is the registry number for Endophenazine A. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 1 mg, 10 mg, 25 mg.
Endophenazine A is a member of phenazines.
Source: ChEBI
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 9-(3-methylbut-2-enyl)phenazine-1-carboxylic acid |
| InChIKey | WLQXISHGKXGNFV-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=CC=C1)N=C3C=CC=C(C3=N2)C(=O)O)C |
Computed by PubChem (NCBI)