Products 861382-34-5
CAS 861382-34-5 is the registry number for Antileishmanial agent-31. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-3,5-dimethyl-1-phenylpyrazole (CAS 861382-34-5) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 4-chloro-3,5-dimethyl-1-phenylpyrazole. InChIKey: BZPZLJTUFNDMQK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 4-chloro-3,5-dimethyl-1-phenylpyrazole |
| InChIKey | BZPZLJTUFNDMQK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antileishmanial agent-31, orb2814530