Products 862416-30-6
CAS 862416-30-6 is the registry number for 4-(Benzylamino)-3,3-difluoro-4-oxobutanoic Acid, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-(benzylamino)-3,3-difluoro-4-oxobutanoic acid (CAS 862416-30-6) is a chemical compound with the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. IUPAC name: 4-(benzylamino)-3,3-difluoro-4-oxobutanoic acid. InChIKey: SOQHLXBYJHANMS-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO3 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-(benzylamino)-3,3-difluoro-4-oxobutanoic acid |
| InChIKey | SOQHLXBYJHANMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C(CC(=O)O)(F)F |
Computed by PubChem (NCBI)