CAS 864263-36-5 is the registry number for (4-(2-Methyl-1,3-thiazol-4-yl)phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine (CAS 864263-36-5) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: [4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine. InChIKey: AFFGOTFVNVMPSM-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | [4-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine |
| InChIKey | AFFGOTFVNVMPSM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)