CAS 864436-94-2 appears in our catalog under these names: 5-(Boc-amino)-thiazole-4-carboxylic acid, 97%, 5-((tert-Butoxycarbonyl)amino)thiazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylic acid (CAS 864436-94-2) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylic acid. InChIKey: SXJLZPMJYRHYDV-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-4-carboxylic acid |
| InChIKey | SXJLZPMJYRHYDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N=CS1)C(=O)O |
Computed by PubChem (NCBI)