CAS 864437-46-7 appears in our catalog under these names: 5-Benzyl-1,3-thiazole-4-carboxylic acid, 95%, 5-Benzyl-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-benzyl-1,3-thiazole-4-carboxylic acid (CAS 864437-46-7) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 5-benzyl-1,3-thiazole-4-carboxylic acid. InChIKey: HVKBEODEJZOBGK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 5-benzyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | HVKBEODEJZOBGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(N=CS2)C(=O)O |
Computed by PubChem (NCBI)