Products 864461-20-1

CAS 864461-20-1 is the registry number for 5-Methyl-2-(thiophen-3-yl)-1H-imidazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-2-thiophen-3-yl-1H-imidazole-4-carboxylic acid (CAS 864461-20-1) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 5-methyl-2-thiophen-3-yl-1H-imidazole-4-carboxylic acid. InChIKey: MOOBFZQZPCORLK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O2S
Molecular weight208.24 g/mol
IUPAC name5-methyl-2-thiophen-3-yl-1H-imidazole-4-carboxylic acid
InChIKeyMOOBFZQZPCORLK-UHFFFAOYSA-N
SMILESCC1=C(N=C(N1)C2=CSC=C2)C(=O)O

Computed by PubChem (NCBI)