Products 864763-61-1
CAS 864763-61-1 is the registry number for Gnetucleistol C. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
5-(4-methoxy-1-benzofuran-2-yl)benzene-1,3-diol (CAS 864763-61-1) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 5-(4-methoxy-1-benzofuran-2-yl)benzene-1,3-diol. InChIKey: QVTAJIWJPWMJLB-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 5-(4-methoxy-1-benzofuran-2-yl)benzene-1,3-diol |
| InChIKey | QVTAJIWJPWMJLB-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C=C(O2)C3=CC(=CC(=C3)O)O |
Computed by PubChem (NCBI)