Products 865106-47-4
CAS 865106-47-4 is the registry number for 6,8-Difluoro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,8-difluoro-4H-1,4-benzoxazin-3-one (CAS 865106-47-4) is a chemical compound with the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. IUPAC name: 6,8-difluoro-4H-1,4-benzoxazin-3-one. InChIKey: WNXKEIFWEKFERH-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO2 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | 6,8-difluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | WNXKEIFWEKFERH-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)