Products 865307-73-9
CAS 865307-73-9 appears in our catalog under these names: 1-Methyl-4-[(1-methyl-1H-imidazole-2-carbonyl)-amino]-1H-pyrrole-2-carboxylic acid, 95%, 1-Methyl-4-(1-methyl-1H-imidazole-2-carboxamido)-1H-pyrrole-2-carboxylic acid, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 250mg.
1-methyl-4-[(1-methylimidazole-2-carbonyl)amino]pyrrole-2-carboxylic acid (CAS 865307-73-9) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: 1-methyl-4-[(1-methylimidazole-2-carbonyl)amino]pyrrole-2-carboxylic acid. InChIKey: UUENVTHPJIDBSK-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O3 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 1-methyl-4-[(1-methylimidazole-2-carbonyl)amino]pyrrole-2-carboxylic acid |
| InChIKey | UUENVTHPJIDBSK-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C(=O)NC2=CN(C(=C2)C(=O)O)C |
Computed by PubChem (NCBI)