Products 865488-53-5
CAS 865488-53-5 appears in our catalog under these names: Dm-nofd, DM-NOFD, 99.81%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, 5 mg, 1 mg, 10 mg.
Methyl (2R)-2-[(2-methoxy-2-oxoacetyl)amino]-3-phenylpropanoate (CAS 865488-53-5) is a chemical compound with the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. IUPAC name: methyl (2R)-2-[(2-methoxy-2-oxoacetyl)amino]-3-phenylpropanoate. InChIKey: CAUUPQLNYYFMOQ-SNVBAGLBSA-N.
| Molecular formula | C13H15NO5 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methoxy-2-oxoacetyl)amino]-3-phenylpropanoate |
| InChIKey | CAUUPQLNYYFMOQ-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)C(=O)OC |
Computed by PubChem (NCBI)