CAS 86674-92-2 appears in our catalog under these names: 4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane, 4-(Chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane (CAS 86674-92-2) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane. InChIKey: PWUSSDSFKIJXBB-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-dioxolane |
| InChIKey | PWUSSDSFKIJXBB-UHFFFAOYSA-N |
| SMILES | C1C(OC(O1)C2=CC=C(C=C2)Cl)CCl |
Computed by PubChem (NCBI)