CAS 869676-40-4 is the registry number for 2-(Trifluoromethyl)phenyl chloroformate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[2-(trifluoromethyl)phenyl] carbonochloridate (CAS 869676-40-4) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: [2-(trifluoromethyl)phenyl] carbonochloridate. InChIKey: LWAIYGCOHDGJDG-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | [2-(trifluoromethyl)phenyl] carbonochloridate |
| InChIKey | LWAIYGCOHDGJDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)OC(=O)Cl |
Computed by PubChem (NCBI)