Products 869901-13-3
CAS 869901-13-3 is the registry number for 3-(Chloromethyl)-1-methyl-5-phenyl-1H-pyrazole, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG.
3-(chloromethyl)-1-methyl-5-phenylpyrazole (CAS 869901-13-3) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 3-(chloromethyl)-1-methyl-5-phenylpyrazole. InChIKey: KAZKAWDJSYXNGK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 3-(chloromethyl)-1-methyl-5-phenylpyrazole |
| InChIKey | KAZKAWDJSYXNGK-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)CCl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)