CAS 87068-75-5 appears in our catalog under these names: (2S)-2-(Phenylformamido)butanoic acid, 95%, (2S)-2-(Phenylformamido)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
(2S)-2-benzamidobutanoic acid (CAS 87068-75-5) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: (2S)-2-benzamidobutanoic acid. InChIKey: OACIMSFRSUBGQU-VIFPVBQESA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | (2S)-2-benzamidobutanoic acid |
| InChIKey | OACIMSFRSUBGQU-VIFPVBQESA-N |
| SMILES | CC[C@@H](C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)