CAS 870966-25-9 is the registry number for Evocalcet Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-N-[(1R)-1-naphthalen-1-ylethyl]pyrrolidin-3-amine (CAS 870966-25-9) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (3S)-N-[(1R)-1-naphthalen-1-ylethyl]pyrrolidin-3-amine. InChIKey: ZGVXBJUAKRUANW-OCCSQVGLSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (3S)-N-[(1R)-1-naphthalen-1-ylethyl]pyrrolidin-3-amine |
| InChIKey | ZGVXBJUAKRUANW-OCCSQVGLSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N[C@H]3CCNC3 |
Computed by PubChem (NCBI)