Products 871085-96-0
CAS 871085-96-0 is the registry number for (3R,4S)-ethyl 1-benzyl-4-hydroxy-5-oxopyrrolidine-3- Carboxylate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl (3R,4S)-1-benzyl-4-hydroxy-5-oxopyrrolidine-3-carboxylate (CAS 871085-96-0) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: ethyl (3R,4S)-1-benzyl-4-hydroxy-5-oxopyrrolidine-3-carboxylate. InChIKey: YKDLEHPCPKSCPK-NEPJUHHUSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | ethyl (3R,4S)-1-benzyl-4-hydroxy-5-oxopyrrolidine-3-carboxylate |
| InChIKey | YKDLEHPCPKSCPK-NEPJUHHUSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C(=O)[C@H]1O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)