CAS 871544-52-4 appears in our catalog under these names: 4-Methyl-2-(thiophen-3-yl)-1,3-thiazole-5-carboxylic acid, 95%, 4-Methyl-2-(thiophen-3-yl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylic acid (CAS 871544-52-4) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylic acid. InChIKey: OGULDBMEXPEPDX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | OGULDBMEXPEPDX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CSC=C2)C(=O)O |
Computed by PubChem (NCBI)