Products 871547-64-7
CAS 871547-64-7 appears in our catalog under these names: 4-(2-Methyl-1,3-thiazol-4-yl)-1h-pyrrole-2-carboxylic acid, 97%, 4-(2-Methylthiazol-4-yl)-1H-pyrrole-2-carboxylic acid, 95%, 4-(2-Methyl-1,3-thiazol-4-yl)-1h-pyrrole-2-carboxylic acid, 4-(2-Methylthiazol-4-yl),-1H-pyrrole-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid (CAS 871547-64-7) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid. InChIKey: OHPWUXLRWDOXFY-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | OHPWUXLRWDOXFY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CNC(=C2)C(=O)O |
Computed by PubChem (NCBI)